C14H29BrO4Si — CID 11210874
ethyl (2S,3R)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylpentanoate (PubChem CID 11210874) has the molecular formula C14H29BrO4Si and a molecular weight of 369.37 g/mol. Its IUPAC name is ethyl (2S,3R)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylpentanoate.
| Compound Name | ethyl (2S,3R)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylpentanoate |
|---|---|
| PubChem CID | 11210874 |
| Molecular Formula | C14H29BrO4Si |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | ethyl (2S,3R)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylpentanoate |
| SMILES | CCOC(=O)[C@@](C)(Br)[C@H](O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H29BrO4Si/c1-8-18-12(17)14(5,15)11(16)9-10-19-20(6,7)13(2,3)4/h11,16H,8-10H2,1-7H3/t11-,14+/m1/s1 |
| InChIKey | ZXDMNAALIXHHKL-RISCZKNCSA-N |
| XLogP | 3.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|