C12H28O3Si — CID 71545770
(3S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpentane-2,3-diol (PubChem CID 71545770) has the molecular formula C12H28O3Si and a molecular weight of 248.44 g/mol. Its IUPAC name is (3S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpentane-2,3-diol.
| Compound Name | (3S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpentane-2,3-diol |
|---|---|
| PubChem CID | 71545770 |
| Molecular Formula | C12H28O3Si |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (3S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpentane-2,3-diol |
| SMILES | CC(C)(O)[C@@H](O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H28O3Si/c1-11(2,3)16(6,7)15-9-8-10(13)12(4,5)14/h10,13-14H,8-9H2,1-7H3/t10-/m0/s1 |
| InChIKey | HHRKZJXCSSJXHM-JTQLQIEISA-N |
| XLogP | 2.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|