C13H30O4Si — CID 10755088
(3R,4R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methylhexane-1,2,4-triol (PubChem CID 10755088) has the molecular formula C13H30O4Si and a molecular weight of 278.47 g/mol. Its IUPAC name is (3R,4R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methylhexane-1,2,4-triol.
| Compound Name | (3R,4R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methylhexane-1,2,4-triol |
|---|---|
| PubChem CID | 10755088 |
| Molecular Formula | C13H30O4Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (3R,4R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methylhexane-1,2,4-triol |
| SMILES | C[C@@H](C(O)CO)[C@H](O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H30O4Si/c1-10(12(16)9-14)11(15)7-8-17-18(5,6)13(2,3)4/h10-12,14-16H,7-9H2,1-6H3/t10-,11-,12?/m1/s1 |
| InChIKey | OECJITVLZLWFTG-XFKKCKKNSA-N |
| XLogP | 1.75 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|