C22H50O4Si2 — CID 11235887
(2R,3S,4S)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-tri(propan-2-yl)silyloxyhexane-1,2-diol (PubChem CID 11235887) has the molecular formula C22H50O4Si2 and a molecular weight of 434.81 g/mol. Its IUPAC name is (2R,3S,4S)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-tri(propan-2-yl)silyloxyhexane-1,2-diol.
| Compound Name | (2R,3S,4S)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-tri(propan-2-yl)silyloxyhexane-1,2-diol |
|---|---|
| PubChem CID | 11235887 |
| Molecular Formula | C22H50O4Si2 |
| Molecular Weight | 434.81 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | (2R,3S,4S)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-tri(propan-2-yl)silyloxyhexane-1,2-diol |
| SMILES | CC(C)[Si](O[C@@H](CCO[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](O)CO)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H50O4Si2/c1-16(2)28(17(3)4,18(5)6)26-21(19(7)20(24)15-23)13-14-25-27(11,12)22(8,9)10/h16-21,23-24H,13-15H2,1-12H3/t19-,20-,21-/m0/s1 |
| InChIKey | PPAORBKPQYBMCF-ACRUOGEOSA-N |
| XLogP | 5.95 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.81 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|