C15H32O2Si — CID 135045339
(E,2R,5S)-7-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhept-3-en-1-ol (PubChem CID 135045339) has the molecular formula C15H32O2Si and a molecular weight of 272.50 g/mol. Its IUPAC name is (E,2R,5S)-7-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhept-3-en-1-ol.
| Compound Name | (E,2R,5S)-7-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhept-3-en-1-ol |
|---|---|
| PubChem CID | 135045339 |
| Molecular Formula | C15H32O2Si |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | (E,2R,5S)-7-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhept-3-en-1-ol |
| SMILES | C[C@H](/C=C/[C@@H](C)CCO[Si](C)(C)C(C)(C)C)CO |
| InChI | InChI=1S/C15H32O2Si/c1-13(8-9-14(2)12-16)10-11-17-18(6,7)15(3,4)5/h8-9,13-14,16H,10-12H2,1-7H3/b9-8+/t13-,14-/m1/s1 |
| InChIKey | BBXFTZYFBKJCMQ-SJXIGLKTSA-N |
| XLogP | 4.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|