C13H28O3Si — CID 53255144
(Z,5R)-7-[tert-butyl(dimethyl)silyl]oxyhept-2-ene-1,5-diol (PubChem CID 53255144) has the molecular formula C13H28O3Si and a molecular weight of 260.45 g/mol. Its IUPAC name is (Z,5R)-7-[tert-butyl(dimethyl)silyl]oxyhept-2-ene-1,5-diol.
| Compound Name | (Z,5R)-7-[tert-butyl(dimethyl)silyl]oxyhept-2-ene-1,5-diol |
|---|---|
| PubChem CID | 53255144 |
| Molecular Formula | C13H28O3Si |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (Z,5R)-7-[tert-butyl(dimethyl)silyl]oxyhept-2-ene-1,5-diol |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H](O)C/C=C\CO |
| InChI | InChI=1S/C13H28O3Si/c1-13(2,3)17(4,5)16-11-9-12(15)8-6-7-10-14/h6-7,12,14-15H,8-11H2,1-5H3/b7-6-/t12-/m1/s1 |
| InChIKey | WQFKRUVZURXVLE-ZHRWSRJISA-N |
| XLogP | 2.70 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|