C19H30O3Si — CID 132520727
(E)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-1-phenylhept-2-en-1-one (PubChem CID 132520727) has the molecular formula C19H30O3Si and a molecular weight of 334.53 g/mol. Its IUPAC name is (E)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-1-phenylhept-2-en-1-one.
| Compound Name | (E)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-1-phenylhept-2-en-1-one |
|---|---|
| PubChem CID | 132520727 |
| Molecular Formula | C19H30O3Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (E)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-1-phenylhept-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(O)C/C=C/C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H30O3Si/c1-19(2,3)23(4,5)22-15-14-17(20)12-9-13-18(21)16-10-7-6-8-11-16/h6-11,13,17,20H,12,14-15H2,1-5H3/b13-9+ |
| InChIKey | UBQJIBXRBZNNQL-UKTHLTGXSA-N |
| XLogP | 4.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|