C19H30O3Si — CID 168819463
1-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl benzoate (PubChem CID 168819463) has the molecular formula C19H30O3Si and a molecular weight of 334.53 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl benzoate.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl benzoate |
|---|---|
| PubChem CID | 168819463 |
| Molecular Formula | C19H30O3Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl benzoate |
| SMILES | C=CCC(CCO[Si](C)(C)C(C)(C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H30O3Si/c1-7-11-17(14-15-21-23(5,6)19(2,3)4)22-18(20)16-12-9-8-10-13-16/h7-10,12-13,17H,1,11,14-15H2,2-6H3 |
| InChIKey | FGGUBZSGMKGUIC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|