C18H27BrO3Si — CID 122384126
[(Z)-4-bromo-5-[tert-butyl(dimethyl)silyl]oxypent-3-enyl] benzoate (PubChem CID 122384126) has the molecular formula C18H27BrO3Si and a molecular weight of 399.40 g/mol. Its IUPAC name is [(Z)-4-bromo-5-[tert-butyl(dimethyl)silyl]oxypent-3-enyl] benzoate.
| Compound Name | [(Z)-4-bromo-5-[tert-butyl(dimethyl)silyl]oxypent-3-enyl] benzoate |
|---|---|
| PubChem CID | 122384126 |
| Molecular Formula | C18H27BrO3Si |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | [(Z)-4-bromo-5-[tert-butyl(dimethyl)silyl]oxypent-3-enyl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)OC/C(Br)=C/CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H27BrO3Si/c1-18(2,3)23(4,5)22-14-16(19)12-9-13-21-17(20)15-10-7-6-8-11-15/h6-8,10-12H,9,13-14H2,1-5H3/b16-12- |
| InChIKey | DKOMHWVSHOZUBC-VBKFSLOCSA-N |
| XLogP | 5.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|