C30H44O5Si — CID 71769205
2-[(1R,3aR,4R,7aR)-1-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-2-en-2-yl]-7a-methyl-3,5-dioxo-1,2,3a,4,6,7-hexahydroinden-4-yl]ethyl benzoate (PubChem CID 71769205) has the molecular formula C30H44O5Si and a molecular weight of 512.76 g/mol. Its IUPAC name is 2-[(1R,3aR,4R,7aR)-1-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-2-en-2-yl]-7a-methyl-3,5-dioxo-1,2,3a,4,6,7-hexahydroinden-4-yl]ethyl benzoate.
| Compound Name | 2-[(1R,3aR,4R,7aR)-1-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-2-en-2-yl]-7a-methyl-3,5-dioxo-1,2,3a,4,6,7-hexahydroinden-4-yl]ethyl benzoate |
|---|---|
| PubChem CID | 71769205 |
| Molecular Formula | C30H44O5Si |
| Molecular Weight | 512.76 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | 2-[(1R,3aR,4R,7aR)-1-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-2-en-2-yl]-7a-methyl-3,5-dioxo-1,2,3a,4,6,7-hexahydroinden-4-yl]ethyl benzoate |
| SMILES | C/C(=C\CCO[Si](C)(C)C(C)(C)C)[C@H]1CC(=O)[C@@H]2[C@@H](CCOC(=O)c3ccccc3)C(=O)CC[C@]12C |
| InChI | InChI=1S/C30H44O5Si/c1-21(12-11-18-35-36(6,7)29(2,3)4)24-20-26(32)27-23(25(31)15-17-30(24,27)5)16-19-34-28(33)22-13-9-8-10-14-22/h8-10,12-14,23-24,27H,11,15-20H2,1-7H3/b21-12+/t23-,24+,27-,30+/m0/s1 |
| InChIKey | VYPBJAUDFDKZGV-ZEQYCJBVSA-N |
| XLogP | 6.78 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.76 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|