C27H50O4Si2 — CID 163284383
[5-[tert-butyl(dimethyl)silyl]oxy-4-tri(propan-2-yl)silyloxypentyl] benzoate (PubChem CID 163284383) has the molecular formula C27H50O4Si2 and a molecular weight of 494.87 g/mol. Its IUPAC name is [5-[tert-butyl(dimethyl)silyl]oxy-4-tri(propan-2-yl)silyloxypentyl] benzoate.
| Compound Name | [5-[tert-butyl(dimethyl)silyl]oxy-4-tri(propan-2-yl)silyloxypentyl] benzoate |
|---|---|
| PubChem CID | 163284383 |
| Molecular Formula | C27H50O4Si2 |
| Molecular Weight | 494.87 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | [5-[tert-butyl(dimethyl)silyl]oxy-4-tri(propan-2-yl)silyloxypentyl] benzoate |
| SMILES | CC(C)[Si](OC(CCCOC(=O)c1ccccc1)CO[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H50O4Si2/c1-21(2)33(22(3)4,23(5)6)31-25(20-30-32(10,11)27(7,8)9)18-15-19-29-26(28)24-16-13-12-14-17-24/h12-14,16-17,21-23,25H,15,18-20H2,1-11H3 |
| InChIKey | VLHLALCROPKRIJ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.87 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|