C21H28O3Si — CID 100980037
[2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl] benzoate (PubChem CID 100980037) has the molecular formula C21H28O3Si and a molecular weight of 356.54 g/mol. Its IUPAC name is [2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl] benzoate.
| Compound Name | [2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl] benzoate |
|---|---|
| PubChem CID | 100980037 |
| Molecular Formula | C21H28O3Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | [2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)OCC(OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28O3Si/c1-21(2,3)25(4,5)23-16-19(17-12-8-6-9-13-17)24-20(22)18-14-10-7-11-15-18/h6-15,19H,16H2,1-5H3 |
| InChIKey | XFNWFUMFDYSJJR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|