C20H30O4Si — CID 102274261
[(4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-5-methylcyclopenten-1-yl]methyl benzoate (PubChem CID 102274261) has the molecular formula C20H30O4Si and a molecular weight of 362.54 g/mol. Its IUPAC name is [(4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-5-methylcyclopenten-1-yl]methyl benzoate.
| Compound Name | [(4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-5-methylcyclopenten-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 102274261 |
| Molecular Formula | C20H30O4Si |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | [(4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-5-methylcyclopenten-1-yl]methyl benzoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC=C(COC(=O)c2ccccc2)[C@]1(C)O |
| InChI | InChI=1S/C20H30O4Si/c1-19(2,3)25(5,6)24-17-13-12-16(20(17,4)22)14-23-18(21)15-10-8-7-9-11-15/h7-12,17,22H,13-14H2,1-6H3/t17-,20-/m0/s1 |
| InChIKey | FKMFHECGLILCOE-PXNSSMCTSA-N |
| XLogP | 4.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|