C17H20O2 — CID 11868389
[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate (PubChem CID 11868389) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is [(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate.
| Compound Name | [(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate |
|---|---|
| PubChem CID | 11868389 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | [(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate |
| SMILES | CC1(C)[C@@H]2CC=C(COC(=O)c3ccccc3)[C@H]1C2 |
| InChI | InChI=1S/C17H20O2/c1-17(2)14-9-8-13(15(17)10-14)11-19-16(18)12-6-4-3-5-7-12/h3-8,14-15H,9-11H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | YUXLMPQJQGGWGZ-HUUCEWRRSA-N |
| XLogP | 3.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|