About [(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate
[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate (PubChem CID 11868389) has the molecular formula C17H20O2
and a molecular weight of 256.34 g/mol. Its IUPAC name is [(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate.
Molecular Properties
| Compound Name | [(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate |
| PubChem CID | 11868389 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | [(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate |
| SMILES | CC1(C)[C@@H]2CC=C(COC(=O)c3ccccc3)[C@H]1C2 |
| InChI | InChI=1S/C17H20O2/c1-17(2)14-9-8-13(15(17)10-14)11-19-16(18)12-6-4-3-5-7-12/h3-8,14-15H,9-11H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | YUXLMPQJQGGWGZ-HUUCEWRRSA-N |
| XLogP | 3.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate?
The IUPAC name of [(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate (CID 11868389) is [(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate.
What is the SMILES notation for [(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate?
The canonical SMILES for [(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate is CC1(C)[C@@H]2CC=C(COC(=O)c3ccccc3)[C@H]1C2.
What is the InChIKey of [(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate?
The InChIKey is YUXLMPQJQGGWGZ-HUUCEWRRSA-N. The full InChI is InChI=1S/C17H20O2/c1-17(2)14-9-8-13(15(17)10-14)11-19-16(18)12-6-4-3-5-7-12/h3-8,14-15H,9-11H2,1-2H3/t14-,15-/m1/s1.
What are the key properties of [(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate?
[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate has a molecular weight of 256.34 g/mol, XLogP of 3.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl benzoate is sourced from PubChem (CID 11868389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).