C19H24O3 — CID 4257841
2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)ethyl 2-phenoxyacetate (PubChem CID 4257841) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)ethyl 2-phenoxyacetate.
| Compound Name | 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)ethyl 2-phenoxyacetate |
|---|---|
| PubChem CID | 4257841 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)ethyl 2-phenoxyacetate |
| SMILES | CC1(C)C2CC=C(CCOC(=O)COc3ccccc3)C1C2 |
| InChI | InChI=1S/C19H24O3/c1-19(2)15-9-8-14(17(19)12-15)10-11-21-18(20)13-22-16-6-4-3-5-7-16/h3-8,15,17H,9-13H2,1-2H3 |
| InChIKey | GTEIQTNJODAUCK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|