C16H19NO2 — CID 141433894
[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl] 4-aminobenzoate (PubChem CID 141433894) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl] 4-aminobenzoate.
| Compound Name | [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl] 4-aminobenzoate |
|---|---|
| PubChem CID | 141433894 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl] 4-aminobenzoate |
| SMILES | CC1(C)[C@H]2CC=C(OC(=O)c3ccc(N)cc3)[C@@H]1C2 |
| InChI | InChI=1S/C16H19NO2/c1-16(2)11-5-8-14(13(16)9-11)19-15(18)10-3-6-12(17)7-4-10/h3-4,6-8,11,13H,5,9,17H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | PSDBXHBNLDGTTJ-AAEUAGOBSA-N |
| XLogP | 3.38 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|