About (4-aminonaphthalen-1-yl) 4-aminobenzoate;(4-aminophenyl) 4-aminobenzoate
(4-aminonaphthalen-1-yl) 4-aminobenzoate;(4-aminophenyl) 4-aminobenzoate (PubChem CID 162060432) has the molecular formula C30H26N4O4
and a molecular weight of 506.56 g/mol. Its IUPAC name is (4-aminonaphthalen-1-yl) 4-aminobenzoate;(4-aminophenyl) 4-aminobenzoate.
Molecular Properties
| Compound Name | (4-aminonaphthalen-1-yl) 4-aminobenzoate;(4-aminophenyl) 4-aminobenzoate |
| PubChem CID | 162060432 |
| Molecular Formula | C30H26N4O4 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | (4-aminonaphthalen-1-yl) 4-aminobenzoate;(4-aminophenyl) 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)Oc2ccc(N)c3ccccc23)cc1.Nc1ccc(OC(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C17H14N2O2.C13H12N2O2/c18-12-7-5-11(6-8-12)17(20)21-16-10-9-15(19)13-3-1-2-4-14(13)16;14-10-3-1-9(2-4-10)13(16)17-12-7-5-11(15)6-8-12/h1-10H,18-19H2;1-8H,14-15H2 |
| InChIKey | YZTLUPIGONHZGT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 156.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-aminonaphthalen-1-yl) 4-aminobenzoate;(4-aminophenyl) 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminonaphthalen-1-yl) 4-aminobenzoate;(4-aminophenyl) 4-aminobenzoate?
The IUPAC name of (4-aminonaphthalen-1-yl) 4-aminobenzoate;(4-aminophenyl) 4-aminobenzoate (CID 162060432) is (4-aminonaphthalen-1-yl) 4-aminobenzoate;(4-aminophenyl) 4-aminobenzoate.
What is the SMILES notation for (4-aminonaphthalen-1-yl) 4-aminobenzoate;(4-aminophenyl) 4-aminobenzoate?
The canonical SMILES for (4-aminonaphthalen-1-yl) 4-aminobenzoate;(4-aminophenyl) 4-aminobenzoate is Nc1ccc(C(=O)Oc2ccc(N)c3ccccc23)cc1.Nc1ccc(OC(=O)c2ccc(N)cc2)cc1.
What is the InChIKey of (4-aminonaphthalen-1-yl) 4-aminobenzoate;(4-aminophenyl) 4-aminobenzoate?
The InChIKey is YZTLUPIGONHZGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O2.C13H12N2O2/c18-12-7-5-11(6-8-12)17(20)21-16-10-9-15(19)13-3-1-2-4-14(13)16;14-10-3-1-9(2-4-10)13(16)17-12-7-5-11(15)6-8-12/h1-10H,18-19H2;1-8H,14-15H2.
What are the key properties of (4-aminonaphthalen-1-yl) 4-aminobenzoate;(4-aminophenyl) 4-aminobenzoate?
(4-aminonaphthalen-1-yl) 4-aminobenzoate;(4-aminophenyl) 4-aminobenzoate has a molecular weight of 506.56 g/mol, XLogP of 5.29, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminonaphthalen-1-yl) 4-aminobenzoate;(4-aminophenyl) 4-aminobenzoate is sourced from PubChem (CID 162060432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).