About [4-(4-aminobenzoyl)oxyphenyl]methyl 4-aminobenzoate
[4-(4-aminobenzoyl)oxyphenyl]methyl 4-aminobenzoate (PubChem CID 154692007) has the molecular formula C21H18N2O4
and a molecular weight of 362.39 g/mol. Its IUPAC name is [4-(4-aminobenzoyl)oxyphenyl]methyl 4-aminobenzoate.
Molecular Properties
| Compound Name | [4-(4-aminobenzoyl)oxyphenyl]methyl 4-aminobenzoate |
| PubChem CID | 154692007 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [4-(4-aminobenzoyl)oxyphenyl]methyl 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)OCc2ccc(OC(=O)c3ccc(N)cc3)cc2)cc1 |
| InChI | InChI=1S/C21H18N2O4/c22-17-7-3-15(4-8-17)20(24)26-13-14-1-11-19(12-2-14)27-21(25)16-5-9-18(23)10-6-16/h1-12H,13,22-23H2 |
| InChIKey | QLYVBPHUAUJTGJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-aminobenzoyl)oxyphenyl]methyl 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-aminobenzoyl)oxyphenyl]methyl 4-aminobenzoate?
The IUPAC name of [4-(4-aminobenzoyl)oxyphenyl]methyl 4-aminobenzoate (CID 154692007) is [4-(4-aminobenzoyl)oxyphenyl]methyl 4-aminobenzoate.
What is the SMILES notation for [4-(4-aminobenzoyl)oxyphenyl]methyl 4-aminobenzoate?
The canonical SMILES for [4-(4-aminobenzoyl)oxyphenyl]methyl 4-aminobenzoate is Nc1ccc(C(=O)OCc2ccc(OC(=O)c3ccc(N)cc3)cc2)cc1.
What is the InChIKey of [4-(4-aminobenzoyl)oxyphenyl]methyl 4-aminobenzoate?
The InChIKey is QLYVBPHUAUJTGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O4/c22-17-7-3-15(4-8-17)20(24)26-13-14-1-11-19(12-2-14)27-21(25)16-5-9-18(23)10-6-16/h1-12H,13,22-23H2.
What are the key properties of [4-(4-aminobenzoyl)oxyphenyl]methyl 4-aminobenzoate?
[4-(4-aminobenzoyl)oxyphenyl]methyl 4-aminobenzoate has a molecular weight of 362.39 g/mol, XLogP of 3.43, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-aminobenzoyl)oxyphenyl]methyl 4-aminobenzoate is sourced from PubChem (CID 154692007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).