C31H54B2O9Si2 — CID 90732186
CID 90732186 (PubChem CID 90732186) has the molecular formula C31H54B2O9Si2 and a molecular weight of 648.56 g/mol.
| Compound Name | CID 90732186 |
|---|---|
| PubChem CID | 90732186 |
| Molecular Formula | C31H54B2O9Si2 |
| Molecular Weight | 648.56 g/mol |
| Exact Mass | 648.35 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](CO)[C@H](OC)C1O[Si](C)(C)C(C)(C)C.[B][C@@H]1O[C@H](COC(=O)c2ccccc2)[C@H](OC)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H29BO5Si.C12H25BO4Si/c1-19(2,3)26(5,6)25-16-15(22-4)14(24-17(16)20)12-23-18(21)13-10-8-7-9-11-13;1-12(2,3)18(5,6)17-10-9(15-4)8(7-14)16-11(10)13/h7-11,14-17H,12H2,1-6H3;8-11,14H,7H2,1-6H3/t14-,15+,16?,17-;8-,9+,10?,11-/m11/s1 |
| InChIKey | SHUMUQVWCLNXDX-UVNOHHJCSA-N |
| XLogP | 4.42 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|