C26H35FO6Si — CID 101128904
[(2S,3R,4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-6-(hydroxymethyl)-4-phenylmethoxyoxan-3-yl] benzoate (PubChem CID 101128904) has the molecular formula C26H35FO6Si and a molecular weight of 490.64 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-6-(hydroxymethyl)-4-phenylmethoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-6-(hydroxymethyl)-4-phenylmethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 101128904 |
| Molecular Formula | C26H35FO6Si |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | [(2S,3R,4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-6-(hydroxymethyl)-4-phenylmethoxyoxan-3-yl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OCc2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](F)O[C@@H]1CO |
| InChI | InChI=1S/C26H35FO6Si/c1-26(2,3)34(4,5)33-21-20(16-28)31-24(27)23(32-25(29)19-14-10-7-11-15-19)22(21)30-17-18-12-8-6-9-13-18/h6-15,20-24,28H,16-17H2,1-5H3/t20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | LASGAKCSFCCDFS-GNADVCDUSA-N |
| XLogP | 4.87 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|