C38H41FO6Si — CID 101077973
[(3R,4S,5R,6R)-6-[[(4-ethenylphenyl)methyl-dimethylsilyl]oxymethyl]-2-fluoro-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate (PubChem CID 101077973) has the molecular formula C38H41FO6Si and a molecular weight of 640.82 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-6-[[(4-ethenylphenyl)methyl-dimethylsilyl]oxymethyl]-2-fluoro-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate.
| Compound Name | [(3R,4S,5R,6R)-6-[[(4-ethenylphenyl)methyl-dimethylsilyl]oxymethyl]-2-fluoro-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 101077973 |
| Molecular Formula | C38H41FO6Si |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | [(3R,4S,5R,6R)-6-[[(4-ethenylphenyl)methyl-dimethylsilyl]oxymethyl]-2-fluoro-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate |
| SMILES | C=Cc1ccc(C[Si](C)(C)OC[C@H]2OC(F)[C@H](OC(=O)c3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C38H41FO6Si/c1-4-28-20-22-31(23-21-28)27-46(2,3)43-26-33-34(41-24-29-14-8-5-9-15-29)35(42-25-30-16-10-6-11-17-30)36(37(39)44-33)45-38(40)32-18-12-7-13-19-32/h4-23,33-37H,1,24-27H2,2-3H3/t33-,34-,35+,36-,37?/m1/s1 |
| InChIKey | TZKZXMYCGHHJNK-YGMGGQQPSA-N |
| XLogP | 7.72 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|