C44H46O7SSi — CID 101077968
[(2S,3R,4S,5R,6R)-2-(benzenesulfinyl)-6-[[(4-ethenylphenyl)methyl-dimethylsilyl]oxymethyl]-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate (PubChem CID 101077968) has the molecular formula C44H46O7SSi and a molecular weight of 747.00 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-2-(benzenesulfinyl)-6-[[(4-ethenylphenyl)methyl-dimethylsilyl]oxymethyl]-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4S,5R,6R)-2-(benzenesulfinyl)-6-[[(4-ethenylphenyl)methyl-dimethylsilyl]oxymethyl]-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 101077968 |
| Molecular Formula | C44H46O7SSi |
| Molecular Weight | 747.00 g/mol |
| Exact Mass | 746.27 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-2-(benzenesulfinyl)-6-[[(4-ethenylphenyl)methyl-dimethylsilyl]oxymethyl]-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate |
| SMILES | C=Cc1ccc(C[Si](C)(C)OC[C@H]2O[C@@H](S(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C44H46O7SSi/c1-4-33-25-27-36(28-26-33)32-53(2,3)49-31-39-40(47-29-34-17-9-5-10-18-34)41(48-30-35-19-11-6-12-20-35)42(51-43(45)37-21-13-7-14-22-37)44(50-39)52(46)38-23-15-8-16-24-38/h4-28,39-42,44H,1,29-32H2,2-3H3/t39-,40-,41+,42-,44+,52?/m1/s1 |
| InChIKey | QSOAGMXNFCUQGL-DFQQBJRISA-N |
| XLogP | 8.56 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.00 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|