C21H22FN3O4 — CID 59982649
[(3S,4R,6S)-5-azido-2-ethyl-6-fluoro-3-phenylmethoxyoxan-4-yl] benzoate (PubChem CID 59982649) has the molecular formula C21H22FN3O4 and a molecular weight of 399.42 g/mol. Its IUPAC name is [(3S,4R,6S)-5-azido-2-ethyl-6-fluoro-3-phenylmethoxyoxan-4-yl] benzoate.
| Compound Name | [(3S,4R,6S)-5-azido-2-ethyl-6-fluoro-3-phenylmethoxyoxan-4-yl] benzoate |
|---|---|
| PubChem CID | 59982649 |
| Molecular Formula | C21H22FN3O4 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | [(3S,4R,6S)-5-azido-2-ethyl-6-fluoro-3-phenylmethoxyoxan-4-yl] benzoate |
| SMILES | CCC1O[C@@H](F)C(N=[N+]=[N-])[C@@H](OC(=O)c2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H22FN3O4/c1-2-16-18(27-13-14-9-5-3-6-10-14)19(17(24-25-23)20(22)28-16)29-21(26)15-11-7-4-8-12-15/h3-12,16-20H,2,13H2,1H3/t16?,17?,18-,19+,20+/m0/s1 |
| InChIKey | KAIHSKHNLPUPSH-GNWGEKMJSA-N |
| XLogP | 4.58 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|