C22H24N4O5 — CID 11091170
[(1S,2S,3R,4S,5S,6S)-4-azido-3,5-bis(phenylmethoxy)-7-oxabicyclo[4.1.0]heptan-2-yl] N-methylcarbamate (PubChem CID 11091170) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is [(1S,2S,3R,4S,5S,6S)-4-azido-3,5-bis(phenylmethoxy)-7-oxabicyclo[4.1.0]heptan-2-yl] N-methylcarbamate.
| Compound Name | [(1S,2S,3R,4S,5S,6S)-4-azido-3,5-bis(phenylmethoxy)-7-oxabicyclo[4.1.0]heptan-2-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 11091170 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [(1S,2S,3R,4S,5S,6S)-4-azido-3,5-bis(phenylmethoxy)-7-oxabicyclo[4.1.0]heptan-2-yl] N-methylcarbamate |
| SMILES | CNC(=O)O[C@@H]1[C@H]2O[C@H]2[C@@H](OCc2ccccc2)C(N=[N+]=[N-])[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H24N4O5/c1-24-22(27)31-20-18(29-13-15-10-6-3-7-11-15)16(25-26-23)17(19-21(20)30-19)28-12-14-8-4-2-5-9-14/h2-11,16-21H,12-13H2,1H3,(H,24,27)/t16?,17-,18+,19-,20-,21-/m0/s1 |
| InChIKey | XCRJABXNZQDFRA-KUQDVAMZSA-N |
| XLogP | 3.34 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|