C62H62N6O16 — CID 139092291
[(3aS,4R,5S,6S,7R,7aS)-6-azido-5,7-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] (2R)-2-acetyloxy-2-phenylacetate (PubChem CID 139092291) has the molecular formula C62H62N6O16 and a molecular weight of 1147.20 g/mol. Its IUPAC name is [(3aS,4R,5S,6S,7R,7aS)-6-azido-5,7-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] (2R)-2-acetyloxy-2-phenylacetate.
| Compound Name | [(3aS,4R,5S,6S,7R,7aS)-6-azido-5,7-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] (2R)-2-acetyloxy-2-phenylacetate |
|---|---|
| PubChem CID | 139092291 |
| Molecular Formula | C62H62N6O16 |
| Molecular Weight | 1147.20 g/mol |
| Exact Mass | 1146.42 |
| IUPAC Name | [(3aS,4R,5S,6S,7R,7aS)-6-azido-5,7-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] (2R)-2-acetyloxy-2-phenylacetate |
| SMILES | CC(=O)O[C@@H](C(=O)O[C@H]1[C@H]2OCO[C@H]2[C@H](OCc2ccccc2)C(N=[N+]=[N-])[C@@H]1OCc1ccccc1)c1ccccc1.CC(=O)O[C@@H](C(=O)O[C@H]1[C@H]2OCO[C@H]2[C@H](OCc2ccccc2)C(N=[N+]=[N-])[C@@H]1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C31H31N3O8/c2*1-20(35)41-25(23-15-9-4-10-16-23)31(36)42-30-27(38-18-22-13-7-3-8-14-22)24(33-34-32)26(28-29(30)40-19-39-28)37-17-21-11-5-2-6-12-21/h2*2-16,24-30H,17-19H2,1H3/t2*24?,25-,26-,27+,28+,29+,30-/m11/s1 |
| InChIKey | QUIJNUAJZKKAPW-XQSHPSQSSA-N |
| XLogP | 9.61 |
| TPSA | 276.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1147.20 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|