C30H36N6O9 — CID 11104112
[(2R,3S,4S,5R,6R)-2-[(2R,3S,4S,5R,6R)-2-acetyloxy-5-azido-6-methyl-4-phenylmethoxyoxan-3-yl]oxy-5-azido-6-methyl-4-phenylmethoxyoxan-3-yl] acetate (PubChem CID 11104112) has the molecular formula C30H36N6O9 and a molecular weight of 624.65 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-2-[(2R,3S,4S,5R,6R)-2-acetyloxy-5-azido-6-methyl-4-phenylmethoxyoxan-3-yl]oxy-5-azido-6-methyl-4-phenylmethoxyoxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-2-[(2R,3S,4S,5R,6R)-2-acetyloxy-5-azido-6-methyl-4-phenylmethoxyoxan-3-yl]oxy-5-azido-6-methyl-4-phenylmethoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 11104112 |
| Molecular Formula | C30H36N6O9 |
| Molecular Weight | 624.65 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-2-[(2R,3S,4S,5R,6R)-2-acetyloxy-5-azido-6-methyl-4-phenylmethoxyoxan-3-yl]oxy-5-azido-6-methyl-4-phenylmethoxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@H](C)[C@@H](N=[N+]=[N-])[C@H](OCc2ccccc2)[C@@H]1O[C@H]1O[C@H](C)[C@@H](N=[N+]=[N-])[C@H](OCc2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H36N6O9/c1-17-24(34-36-32)26(40-16-22-13-9-6-10-14-22)28(29(41-17)44-20(4)38)45-30-27(43-19(3)37)25(23(33-35-31)18(2)42-30)39-15-21-11-7-5-8-12-21/h5-14,17-18,23-30H,15-16H2,1-4H3/t17-,18-,23-,24-,25+,26+,27+,28+,29-,30-/m1/s1 |
| InChIKey | IDDVLXRHBCMKJZ-RWYRUTMQSA-N |
| XLogP | 4.88 |
| TPSA | 196.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.65 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|