C38H46N6O16 — CID 158836513
[(3S,4S,6S)-3,6-diacetyloxy-4-azido-5-phenylmethoxyoxan-2-yl]methyl acetate;[(3S,4S,6R)-3,6-diacetyloxy-4-azido-5-phenylmethoxyoxan-2-yl]methyl acetate (PubChem CID 158836513) has the molecular formula C38H46N6O16 and a molecular weight of 842.81 g/mol. Its IUPAC name is [(3S,4S,6S)-3,6-diacetyloxy-4-azido-5-phenylmethoxyoxan-2-yl]methyl acetate;[(3S,4S,6R)-3,6-diacetyloxy-4-azido-5-phenylmethoxyoxan-2-yl]methyl acetate.
| Compound Name | [(3S,4S,6S)-3,6-diacetyloxy-4-azido-5-phenylmethoxyoxan-2-yl]methyl acetate;[(3S,4S,6R)-3,6-diacetyloxy-4-azido-5-phenylmethoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 158836513 |
| Molecular Formula | C38H46N6O16 |
| Molecular Weight | 842.81 g/mol |
| Exact Mass | 842.30 |
| IUPAC Name | [(3S,4S,6S)-3,6-diacetyloxy-4-azido-5-phenylmethoxyoxan-2-yl]methyl acetate;[(3S,4S,6R)-3,6-diacetyloxy-4-azido-5-phenylmethoxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](OC(C)=O)C(OCc2ccccc2)[C@@H](N=[N+]=[N-])[C@@H]1OC(C)=O.CC(=O)OCC1O[C@H](OC(C)=O)C(OCc2ccccc2)[C@@H](N=[N+]=[N-])[C@@H]1OC(C)=O |
| InChI | InChI=1S/2C19H23N3O8/c2*1-11(23)26-10-15-17(28-12(2)24)16(21-22-20)18(19(30-15)29-13(3)25)27-9-14-7-5-4-6-8-14/h2*4-8,15-19H,9-10H2,1-3H3/t15?,16-,17+,18?,19+;15?,16-,17+,18?,19-/m00/s1 |
| InChIKey | IXRZXEBSEDOXHM-HSDDRPQXSA-N |
| XLogP | 4.07 |
| TPSA | 292.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.81 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|