C27H33N3O9 — CID 11017025
[(2R,3S,4R,5R,6S)-4-acetyloxy-5-azido-6-[2-[(4-methoxyphenyl)methoxy]ethoxy]-3-phenylmethoxyoxan-2-yl]methyl acetate (PubChem CID 11017025) has the molecular formula C27H33N3O9 and a molecular weight of 543.57 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-4-acetyloxy-5-azido-6-[2-[(4-methoxyphenyl)methoxy]ethoxy]-3-phenylmethoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-4-acetyloxy-5-azido-6-[2-[(4-methoxyphenyl)methoxy]ethoxy]-3-phenylmethoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11017025 |
| Molecular Formula | C27H33N3O9 |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-4-acetyloxy-5-azido-6-[2-[(4-methoxyphenyl)methoxy]ethoxy]-3-phenylmethoxyoxan-2-yl]methyl acetate |
| SMILES | COc1ccc(COCCO[C@H]2O[C@H](COC(C)=O)[C@@H](OCc3ccccc3)[C@H](OC(C)=O)[C@H]2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C27H33N3O9/c1-18(31)36-17-23-25(37-16-20-7-5-4-6-8-20)26(38-19(2)32)24(29-30-28)27(39-23)35-14-13-34-15-21-9-11-22(33-3)12-10-21/h4-12,23-27H,13-17H2,1-3H3/t23-,24-,25-,26-,27+/m1/s1 |
| InChIKey | QEFQIYVYYWPCMN-ACFIUOAZSA-N |
| XLogP | 3.71 |
| TPSA | 147.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|