C36H43Cl3N4O13 — CID 158443138
[3-[3-acetyloxy-6-ethyl-5-[(4-methoxyphenyl)methoxy]-4-phenylmethoxyoxan-2-yl]oxy-5-azido-4-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate;carbon dioxide (PubChem CID 158443138) has the molecular formula C36H43Cl3N4O13 and a molecular weight of 846.11 g/mol. Its IUPAC name is [3-[3-acetyloxy-6-ethyl-5-[(4-methoxyphenyl)methoxy]-4-phenylmethoxyoxan-2-yl]oxy-5-azido-4-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate;carbon dioxide.
| Compound Name | [3-[3-acetyloxy-6-ethyl-5-[(4-methoxyphenyl)methoxy]-4-phenylmethoxyoxan-2-yl]oxy-5-azido-4-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate;carbon dioxide |
|---|---|
| PubChem CID | 158443138 |
| Molecular Formula | C36H43Cl3N4O13 |
| Molecular Weight | 846.11 g/mol |
| Exact Mass | 844.19 |
| IUPAC Name | [3-[3-acetyloxy-6-ethyl-5-[(4-methoxyphenyl)methoxy]-4-phenylmethoxyoxan-2-yl]oxy-5-azido-4-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate;carbon dioxide |
| SMILES | O=C=O.[H]/N=C(/OC1OC(COC(C)=O)C(OC2OC(CC)C(OCc3ccc(OC)cc3)C(OCc3ccccc3)C2OC(C)=O)C(C)C1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C35H43Cl3N4O11.CO2/c1-6-25-29(47-17-23-12-14-24(45-5)15-13-23)30(48-16-22-10-8-7-9-11-22)31(49-21(4)44)33(50-25)52-28-19(2)27(41-42-40)32(53-34(39)35(36,37)38)51-26(28)18-46-20(3)43;2-1-3/h7-15,19,25-33,39H,6,16-18H2,1-5H3;/b39-34+; |
| InChIKey | HDBHSEOPPPMQQO-PXNWFBGISA-N |
| XLogP | 6.00 |
| TPSA | 223.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.11 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|