C36H53Cl3N4O14 — CID 89102136
[3-[3-acetyloxy-4-butoxy-5-[(4-methoxyphenyl)methoxy]-6-(2-methylperoxyethyl)oxan-2-yl]oxy-5-azido-4-butoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 89102136) has the molecular formula C36H53Cl3N4O14 and a molecular weight of 872.19 g/mol. Its IUPAC name is [3-[3-acetyloxy-4-butoxy-5-[(4-methoxyphenyl)methoxy]-6-(2-methylperoxyethyl)oxan-2-yl]oxy-5-azido-4-butoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [3-[3-acetyloxy-4-butoxy-5-[(4-methoxyphenyl)methoxy]-6-(2-methylperoxyethyl)oxan-2-yl]oxy-5-azido-4-butoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 89102136 |
| Molecular Formula | C36H53Cl3N4O14 |
| Molecular Weight | 872.19 g/mol |
| Exact Mass | 870.26 |
| IUPAC Name | [3-[3-acetyloxy-4-butoxy-5-[(4-methoxyphenyl)methoxy]-6-(2-methylperoxyethyl)oxan-2-yl]oxy-5-azido-4-butoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/OC1OC(COC(C)=O)C(OC2OC(CCOOC)C(OCc3ccc(OC)cc3)C(OCCCC)C2OC(C)=O)C(OCCCC)C1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C36H53Cl3N4O14/c1-7-9-16-48-30-27(42-43-41)33(57-35(40)36(37,38)39)55-26(20-50-21(3)44)29(30)56-34-32(53-22(4)45)31(49-17-10-8-2)28(25(54-34)15-18-52-47-6)51-19-23-11-13-24(46-5)14-12-23/h11-14,25-34,40H,7-10,15-20H2,1-6H3/b40-35+ |
| InChIKey | ZCUJOZVQYIPMAB-JWVZJPBISA-N |
| XLogP | 6.29 |
| TPSA | 217.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.19 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|