C29H39N3O8 — CID 59765613
tert-butyl 2-[(2R,4R,5R)-3-azido-2-ethoxy-5-[(4-methoxyphenyl)methoxy]-6-(phenylmethoxymethyl)oxan-4-yl]oxyacetate (PubChem CID 59765613) has the molecular formula C29H39N3O8 and a molecular weight of 557.64 g/mol. Its IUPAC name is tert-butyl 2-[(2R,4R,5R)-3-azido-2-ethoxy-5-[(4-methoxyphenyl)methoxy]-6-(phenylmethoxymethyl)oxan-4-yl]oxyacetate.
| Compound Name | tert-butyl 2-[(2R,4R,5R)-3-azido-2-ethoxy-5-[(4-methoxyphenyl)methoxy]-6-(phenylmethoxymethyl)oxan-4-yl]oxyacetate |
|---|---|
| PubChem CID | 59765613 |
| Molecular Formula | C29H39N3O8 |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | tert-butyl 2-[(2R,4R,5R)-3-azido-2-ethoxy-5-[(4-methoxyphenyl)methoxy]-6-(phenylmethoxymethyl)oxan-4-yl]oxyacetate |
| SMILES | CCO[C@@H]1OC(COCc2ccccc2)[C@H](OCc2ccc(OC)cc2)[C@H](OCC(=O)OC(C)(C)C)C1N=[N+]=[N-] |
| InChI | InChI=1S/C29H39N3O8/c1-6-36-28-25(31-32-30)27(38-19-24(33)40-29(2,3)4)26(37-17-21-12-14-22(34-5)15-13-21)23(39-28)18-35-16-20-10-8-7-9-11-20/h7-15,23,25-28H,6,16-19H2,1-5H3/t23?,25?,26-,27+,28+/m0/s1 |
| InChIKey | NDAGCCVGLXERFG-REPUESLDSA-N |
| XLogP | 4.96 |
| TPSA | 130.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|