C24H34N4O9 — CID 89084278
tert-butyl 2-[(3S,4R,6R)-5-acetamido-4-acetyloxy-6-azido-2-[(4-methoxyphenyl)methoxymethyl]oxan-3-yl]oxyacetate (PubChem CID 89084278) has the molecular formula C24H34N4O9 and a molecular weight of 522.56 g/mol. Its IUPAC name is tert-butyl 2-[(3S,4R,6R)-5-acetamido-4-acetyloxy-6-azido-2-[(4-methoxyphenyl)methoxymethyl]oxan-3-yl]oxyacetate.
| Compound Name | tert-butyl 2-[(3S,4R,6R)-5-acetamido-4-acetyloxy-6-azido-2-[(4-methoxyphenyl)methoxymethyl]oxan-3-yl]oxyacetate |
|---|---|
| PubChem CID | 89084278 |
| Molecular Formula | C24H34N4O9 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | tert-butyl 2-[(3S,4R,6R)-5-acetamido-4-acetyloxy-6-azido-2-[(4-methoxyphenyl)methoxymethyl]oxan-3-yl]oxyacetate |
| SMILES | COc1ccc(COCC2O[C@@H](N=[N+]=[N-])C(NC(C)=O)[C@@H](OC(C)=O)[C@@H]2OCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H34N4O9/c1-14(29)26-20-22(35-15(2)30)21(34-13-19(31)37-24(3,4)5)18(36-23(20)27-28-25)12-33-11-16-7-9-17(32-6)10-8-16/h7-10,18,20-23H,11-13H2,1-6H3,(H,26,29)/t18?,20?,21-,22-,23-/m1/s1 |
| InChIKey | GGZHWHFKTVFCIF-UNWXKSQRSA-N |
| XLogP | 2.41 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|