C19H25N5O7 — CID 118040299
[(2R,3R,4S,5R,6R)-3,5-diacetamido-2-(azidomethyl)-6-(4-methoxyphenoxy)oxan-4-yl] acetate (PubChem CID 118040299) has the molecular formula C19H25N5O7 and a molecular weight of 435.44 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,5-diacetamido-2-(azidomethyl)-6-(4-methoxyphenoxy)oxan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,5-diacetamido-2-(azidomethyl)-6-(4-methoxyphenoxy)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 118040299 |
| Molecular Formula | C19H25N5O7 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,5-diacetamido-2-(azidomethyl)-6-(4-methoxyphenoxy)oxan-4-yl] acetate |
| SMILES | COc1ccc(O[C@H]2O[C@H](CN=[N+]=[N-])[C@@H](NC(C)=O)[C@H](OC(C)=O)[C@H]2NC(C)=O)cc1 |
| InChI | InChI=1S/C19H25N5O7/c1-10(25)22-16-15(9-21-24-20)31-19(30-14-7-5-13(28-4)6-8-14)17(23-11(2)26)18(16)29-12(3)27/h5-8,15-19H,9H2,1-4H3,(H,22,25)(H,23,26)/t15-,16-,17-,18+,19+/m1/s1 |
| InChIKey | AWOSMNCMWYJBJK-QQXKLLMISA-N |
| XLogP | 1.05 |
| TPSA | 160.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|