C24H29N5O7 — CID 118040551
N-[(2R,3R,4S,5R,6R)-5-acetamido-2-(azidomethyl)-4,6-bis(4-methoxyphenoxy)oxan-3-yl]acetamide (PubChem CID 118040551) has the molecular formula C24H29N5O7 and a molecular weight of 499.52 g/mol. Its IUPAC name is N-[(2R,3R,4S,5R,6R)-5-acetamido-2-(azidomethyl)-4,6-bis(4-methoxyphenoxy)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4S,5R,6R)-5-acetamido-2-(azidomethyl)-4,6-bis(4-methoxyphenoxy)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 118040551 |
| Molecular Formula | C24H29N5O7 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | N-[(2R,3R,4S,5R,6R)-5-acetamido-2-(azidomethyl)-4,6-bis(4-methoxyphenoxy)oxan-3-yl]acetamide |
| SMILES | COc1ccc(O[C@H]2O[C@H](CN=[N+]=[N-])[C@@H](NC(C)=O)[C@H](Oc3ccc(OC)cc3)[C@H]2NC(C)=O)cc1 |
| InChI | InChI=1S/C24H29N5O7/c1-14(30)27-21-20(13-26-29-25)36-24(35-19-11-7-17(33-4)8-12-19)22(28-15(2)31)23(21)34-18-9-5-16(32-3)6-10-18/h5-12,20-24H,13H2,1-4H3,(H,27,30)(H,28,31)/t20-,21-,22-,23+,24+/m1/s1 |
| InChIKey | WWLJUNOVZAFRLX-VDLPQLTJSA-N |
| XLogP | 2.57 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|