C36H39N5O15 — CID 91203071
[(3R,4S)-5-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)methoxymethyl]-3-[[(3S,4S,6R)-3,4,5-triacetyloxy-6-azidooxane-2-carbonyl]amino]oxan-4-yl] acetate (PubChem CID 91203071) has the molecular formula C36H39N5O15 and a molecular weight of 781.73 g/mol. Its IUPAC name is [(3R,4S)-5-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)methoxymethyl]-3-[[(3S,4S,6R)-3,4,5-triacetyloxy-6-azidooxane-2-carbonyl]amino]oxan-4-yl] acetate.
| Compound Name | [(3R,4S)-5-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)methoxymethyl]-3-[[(3S,4S,6R)-3,4,5-triacetyloxy-6-azidooxane-2-carbonyl]amino]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 91203071 |
| Molecular Formula | C36H39N5O15 |
| Molecular Weight | 781.73 g/mol |
| Exact Mass | 781.24 |
| IUPAC Name | [(3R,4S)-5-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)methoxymethyl]-3-[[(3S,4S,6R)-3,4,5-triacetyloxy-6-azidooxane-2-carbonyl]amino]oxan-4-yl] acetate |
| SMILES | COc1ccc(COCC2OCC(N3C(=O)c4ccccc4C3=O)[C@@H](OC(C)=O)[C@H]2NC(=O)C2O[C@@H](N=[N+]=[N-])C(OC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C36H39N5O15/c1-17(42)52-28-25(41-35(47)23-8-6-7-9-24(23)36(41)48)15-51-26(16-50-14-21-10-12-22(49-5)13-11-21)27(28)38-33(46)31-29(53-18(2)43)30(54-19(3)44)32(55-20(4)45)34(56-31)39-40-37/h6-13,25-32,34H,14-16H2,1-5H3,(H,38,46)/t25?,26?,27-,28+,29-,30-,31?,32?,34+/m0/s1 |
| InChIKey | FUFJUYYRBHMRAK-SUHWWNRPSA-N |
| XLogP | 1.52 |
| TPSA | 257.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.73 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|