C28H26N4O6 — CID 10907391
2-[(2R,3R,4R,5S,6R)-2-azido-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione (PubChem CID 10907391) has the molecular formula C28H26N4O6 and a molecular weight of 514.54 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5S,6R)-2-azido-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,3R,4R,5S,6R)-2-azido-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10907391 |
| Molecular Formula | C28H26N4O6 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 2-[(2R,3R,4R,5S,6R)-2-azido-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione |
| SMILES | [N-]=[N+]=N[C@@H]1O[C@H](COCc2ccccc2)[C@@H](O)[C@H](OCc2ccccc2)[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H26N4O6/c29-31-30-26-23(32-27(34)20-13-7-8-14-21(20)28(32)35)25(37-16-19-11-5-2-6-12-19)24(33)22(38-26)17-36-15-18-9-3-1-4-10-18/h1-14,22-26,33H,15-17H2/t22-,23-,24-,25-,26-/m1/s1 |
| InChIKey | QMPZBVKAXKGNDM-ZFXZZAOISA-N |
| XLogP | 3.85 |
| TPSA | 134.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|