C23H23NO8 — CID 54049120
[(2R,3S,4R,5R,6R)-5-(1,3-dioxoisoindol-2-yl)-3,6-dihydroxy-4-phenylmethoxyoxan-2-yl]methyl acetate (PubChem CID 54049120) has the molecular formula C23H23NO8 and a molecular weight of 441.44 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-(1,3-dioxoisoindol-2-yl)-3,6-dihydroxy-4-phenylmethoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-(1,3-dioxoisoindol-2-yl)-3,6-dihydroxy-4-phenylmethoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 54049120 |
| Molecular Formula | C23H23NO8 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-(1,3-dioxoisoindol-2-yl)-3,6-dihydroxy-4-phenylmethoxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O)[C@H](N2C(=O)c3ccccc3C2=O)[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C23H23NO8/c1-13(25)30-12-17-19(26)20(31-11-14-7-3-2-4-8-14)18(23(29)32-17)24-21(27)15-9-5-6-10-16(15)22(24)28/h2-10,17-20,23,26,29H,11-12H2,1H3/t17-,18-,19-,20-,23-/m1/s1 |
| InChIKey | LRQLSBTXYASYEE-MTSAVCEVSA-N |
| XLogP | 0.88 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|