C35H33NO8 — CID 68718298
2-[(2R,3R,4R,5S,6R)-2-hydroxy-5-(2-methoxyphenoxy)-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione (PubChem CID 68718298) has the molecular formula C35H33NO8 and a molecular weight of 595.65 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5S,6R)-2-hydroxy-5-(2-methoxyphenoxy)-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,3R,4R,5S,6R)-2-hydroxy-5-(2-methoxyphenoxy)-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 68718298 |
| Molecular Formula | C35H33NO8 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | 2-[(2R,3R,4R,5S,6R)-2-hydroxy-5-(2-methoxyphenoxy)-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione |
| SMILES | COc1ccccc1O[C@H]1[C@H](OCc2ccccc2)[C@@H](N2C(=O)c3ccccc3C2=O)[C@H](O)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C35H33NO8/c1-40-27-18-10-11-19-28(27)43-31-29(22-41-20-23-12-4-2-5-13-23)44-35(39)30(32(31)42-21-24-14-6-3-7-15-24)36-33(37)25-16-8-9-17-26(25)34(36)38/h2-19,29-32,35,39H,20-22H2,1H3/t29-,30-,31-,32-,35-/m1/s1 |
| InChIKey | JCONUWDNKVLCMK-PVEIOGNQSA-N |
| XLogP | 4.63 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|