C30H30BrNO7 — CID 54186877
2-[(2R,3R,4R,5S,6R)-2-(2-bromoethoxy)-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione (PubChem CID 54186877) has the molecular formula C30H30BrNO7 and a molecular weight of 596.47 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5S,6R)-2-(2-bromoethoxy)-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,3R,4R,5S,6R)-2-(2-bromoethoxy)-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 54186877 |
| Molecular Formula | C30H30BrNO7 |
| Molecular Weight | 596.47 g/mol |
| Exact Mass | 595.12 |
| IUPAC Name | 2-[(2R,3R,4R,5S,6R)-2-(2-bromoethoxy)-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@H]1[C@H](OCCBr)O[C@H](COCc2ccccc2)[C@@H](O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H30BrNO7/c31-15-16-37-30-25(32-28(34)22-13-7-8-14-23(22)29(32)35)27(38-18-21-11-5-2-6-12-21)26(33)24(39-30)19-36-17-20-9-3-1-4-10-20/h1-14,24-27,30,33H,15-19H2/t24-,25-,26-,27-,30-/m1/s1 |
| InChIKey | PFSCXYVCOVROHK-ASQLHGERSA-N |
| XLogP | 3.95 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|