C35H36N3O8+ — CID 132532452
[(2R,3R,4R,5S,6R)-3-(1,3-dioxoisoindol-2-yl)-5-hydroxy-2-[[4-[(3-methylimidazol-3-ium-1-yl)methyl]phenyl]methoxy]-6-(phenylmethoxymethyl)oxan-4-yl] acetate (PubChem CID 132532452) has the molecular formula C35H36N3O8+ and a molecular weight of 626.69 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-3-(1,3-dioxoisoindol-2-yl)-5-hydroxy-2-[[4-[(3-methylimidazol-3-ium-1-yl)methyl]phenyl]methoxy]-6-(phenylmethoxymethyl)oxan-4-yl] acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-3-(1,3-dioxoisoindol-2-yl)-5-hydroxy-2-[[4-[(3-methylimidazol-3-ium-1-yl)methyl]phenyl]methoxy]-6-(phenylmethoxymethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 132532452 |
| Molecular Formula | C35H36N3O8+ |
| Molecular Weight | 626.69 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-3-(1,3-dioxoisoindol-2-yl)-5-hydroxy-2-[[4-[(3-methylimidazol-3-ium-1-yl)methyl]phenyl]methoxy]-6-(phenylmethoxymethyl)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](O)[C@@H](COCc2ccccc2)O[C@@H](OCc2ccc(Cn3cc[n+](C)c3)cc2)[C@@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C35H36N3O8/c1-23(39)45-32-30(38-33(41)27-10-6-7-11-28(27)34(38)42)35(46-29(31(32)40)21-43-19-25-8-4-3-5-9-25)44-20-26-14-12-24(13-15-26)18-37-17-16-36(2)22-37/h3-17,22,29-32,35,40H,18-21H2,1-2H3/q+1/t29-,30-,31-,32-,35-/m1/s1 |
| InChIKey | MOEHXSCZKJIWER-PVEIOGNQSA-N |
| XLogP | 2.78 |
| TPSA | 120.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|