C39H43N2O6+ — CID 53386610
(2S,3S,4R,5R,6R)-2-[[4-[(3-methylimidazol-3-ium-1-yl)methyl]phenyl]methoxy]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol (PubChem CID 53386610) has the molecular formula C39H43N2O6+ and a molecular weight of 635.78 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-2-[[4-[(3-methylimidazol-3-ium-1-yl)methyl]phenyl]methoxy]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol.
| Compound Name | (2S,3S,4R,5R,6R)-2-[[4-[(3-methylimidazol-3-ium-1-yl)methyl]phenyl]methoxy]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 53386610 |
| Molecular Formula | C39H43N2O6+ |
| Molecular Weight | 635.78 g/mol |
| Exact Mass | 635.31 |
| IUPAC Name | (2S,3S,4R,5R,6R)-2-[[4-[(3-methylimidazol-3-ium-1-yl)methyl]phenyl]methoxy]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
| SMILES | C[n+]1ccn(Cc2ccc(CO[C@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@@H]3O)cc2)c1 |
| InChI | InChI=1S/C39H43N2O6/c1-40-21-22-41(29-40)23-30-17-19-34(20-18-30)27-46-39-36(42)38(45-26-33-15-9-4-10-16-33)37(44-25-32-13-7-3-8-14-32)35(47-39)28-43-24-31-11-5-2-6-12-31/h2-22,29,35-39,42H,23-28H2,1H3/q+1/t35-,36+,37-,38-,39+/m1/s1 |
| InChIKey | GUCATRIQTKBKDQ-KYFHLAJPSA-N |
| XLogP | 5.35 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.78 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|