C28H27Cl4NO8 — CID 10651802
[(2R,3R,4R,5S,6R)-5-hydroxy-2-pent-4-enoxy-6-(phenylmethoxymethyl)-3-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-4-yl] acetate (PubChem CID 10651802) has the molecular formula C28H27Cl4NO8 and a molecular weight of 647.34 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-5-hydroxy-2-pent-4-enoxy-6-(phenylmethoxymethyl)-3-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-4-yl] acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-5-hydroxy-2-pent-4-enoxy-6-(phenylmethoxymethyl)-3-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 10651802 |
| Molecular Formula | C28H27Cl4NO8 |
| Molecular Weight | 647.34 g/mol |
| Exact Mass | 645.05 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-5-hydroxy-2-pent-4-enoxy-6-(phenylmethoxymethyl)-3-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-4-yl] acetate |
| SMILES | C=CCCCO[C@@H]1O[C@H](COCc2ccccc2)[C@@H](O)[C@H](OC(C)=O)[C@H]1N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C28H27Cl4NO8/c1-3-4-8-11-39-28-23(33-26(36)17-18(27(33)37)20(30)22(32)21(31)19(17)29)25(40-14(2)34)24(35)16(41-28)13-38-12-15-9-6-5-7-10-15/h3,5-7,9-10,16,23-25,28,35H,1,4,8,11-13H2,2H3/t16-,23-,24-,25-,28-/m1/s1 |
| InChIKey | MYBHHIBKUORUDJ-KWHOMZPESA-N |
| XLogP | 5.48 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.34 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|