C34H27Cl4NO6S — CID 170453429
4,5,6,7-tetrachloro-2-[5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)-2-phenylsulfanyloxan-3-yl]isoindole-1,3-dione (PubChem CID 170453429) has the molecular formula C34H27Cl4NO6S and a molecular weight of 719.47 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)-2-phenylsulfanyloxan-3-yl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)-2-phenylsulfanyloxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170453429 |
| Molecular Formula | C34H27Cl4NO6S |
| Molecular Weight | 719.47 g/mol |
| Exact Mass | 717.03 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)-2-phenylsulfanyloxan-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)N1C1C(Sc2ccccc2)OC(COCc2ccccc2)C(O)C1OCc1ccccc1 |
| InChI | InChI=1S/C34H27Cl4NO6S/c35-25-23-24(26(36)28(38)27(25)37)33(42)39(32(23)41)29-31(44-17-20-12-6-2-7-13-20)30(40)22(18-43-16-19-10-4-1-5-11-19)45-34(29)46-21-14-8-3-9-15-21/h1-15,22,29-31,34,40H,16-18H2 |
| InChIKey | UYPXBUUVIPHTEU-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.47 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|