C35H31Cl4NO9 — CID 10963726
[(2S,3R,4R,5S,6R)-5-acetyloxy-4-phenylmethoxy-6-(phenylmethoxymethyl)-3-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl] pent-4-enoate (PubChem CID 10963726) has the molecular formula C35H31Cl4NO9 and a molecular weight of 751.44 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-5-acetyloxy-4-phenylmethoxy-6-(phenylmethoxymethyl)-3-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl] pent-4-enoate.
| Compound Name | [(2S,3R,4R,5S,6R)-5-acetyloxy-4-phenylmethoxy-6-(phenylmethoxymethyl)-3-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl] pent-4-enoate |
|---|---|
| PubChem CID | 10963726 |
| Molecular Formula | C35H31Cl4NO9 |
| Molecular Weight | 751.44 g/mol |
| Exact Mass | 749.08 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-5-acetyloxy-4-phenylmethoxy-6-(phenylmethoxymethyl)-3-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl] pent-4-enoate |
| SMILES | C=CCCC(=O)O[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OC(C)=O)[C@H](OCc2ccccc2)[C@H]1N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C35H31Cl4NO9/c1-3-4-15-23(42)49-35-30(40-33(43)24-25(34(40)44)27(37)29(39)28(38)26(24)36)32(46-17-21-13-9-6-10-14-21)31(47-19(2)41)22(48-35)18-45-16-20-11-7-5-8-12-20/h3,5-14,22,30-32,35H,1,4,15-18H2,2H3/t22-,30-,31-,32-,35+/m1/s1 |
| InChIKey | NXEFSBQAWDXUQO-PSOGITQGSA-N |
| XLogP | 7.23 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.44 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|