C40H31Cl4NO10 — CID 101132187
[(2R,3S,4R,5R,6R)-3,4-dibenzoyloxy-6-pent-4-enoxy-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl benzoate (PubChem CID 101132187) has the molecular formula C40H31Cl4NO10 and a molecular weight of 827.50 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-dibenzoyloxy-6-pent-4-enoxy-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-dibenzoyloxy-6-pent-4-enoxy-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 101132187 |
| Molecular Formula | C40H31Cl4NO10 |
| Molecular Weight | 827.50 g/mol |
| Exact Mass | 825.07 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-dibenzoyloxy-6-pent-4-enoxy-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl benzoate |
| SMILES | C=CCCCO[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C40H31Cl4NO10/c1-2-3-13-20-51-40-32(45-35(46)26-27(36(45)47)29(42)31(44)30(43)28(26)41)34(55-39(50)24-18-11-6-12-19-24)33(54-38(49)23-16-9-5-10-17-23)25(53-40)21-52-37(48)22-14-7-4-8-15-22/h2,4-12,14-19,25,32-34,40H,1,3,13,20-21H2/t25-,32-,33-,34-,40-/m1/s1 |
| InChIKey | DSPFQFWNHCBZNK-WUCYITIKSA-N |
| XLogP | 8.28 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.50 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|