C23H27NO8 — CID 13384782
[(2R,3S,4R,5R,6S)-3,6-dihydroxy-4-phenylmethoxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate (PubChem CID 13384782) has the molecular formula C23H27NO8 and a molecular weight of 445.47 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,6-dihydroxy-4-phenylmethoxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,6-dihydroxy-4-phenylmethoxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 13384782 |
| Molecular Formula | C23H27NO8 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,6-dihydroxy-4-phenylmethoxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](O)[C@H](NC(=O)OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C23H27NO8/c1-15(25)29-14-18-20(26)21(30-12-16-8-4-2-5-9-16)19(22(27)32-18)24-23(28)31-13-17-10-6-3-7-11-17/h2-11,18-22,26-27H,12-14H2,1H3,(H,24,28)/t18-,19-,20-,21-,22+/m1/s1 |
| InChIKey | ONKBVCKJZQTAQV-LMYCIYFBSA-N |
| XLogP | 1.51 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |