C17H23NO8 — CID 11089954
[(2R,3S,4R,5R,6S)-3,4-dihydroxy-6-methoxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate (PubChem CID 11089954) has the molecular formula C17H23NO8 and a molecular weight of 369.37 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4-dihydroxy-6-methoxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4-dihydroxy-6-methoxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11089954 |
| Molecular Formula | C17H23NO8 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4-dihydroxy-6-methoxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO8/c1-10(19)24-9-12-14(20)15(21)13(16(23-2)26-12)18-17(22)25-8-11-6-4-3-5-7-11/h3-7,12-16,20-21H,8-9H2,1-2H3,(H,18,22)/t12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | YCYUHOBMPJXPMC-QCODTGAPSA-N |
| XLogP | -0.06 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |