C19H25NO9 — CID 56630007
[(2R,3S,4R,5R,6S)-4-acetyloxy-2-(hydroxymethyl)-6-methoxy-5-(phenylmethoxycarbonylamino)oxan-3-yl] acetate (PubChem CID 56630007) has the molecular formula C19H25NO9 and a molecular weight of 411.41 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-4-acetyloxy-2-(hydroxymethyl)-6-methoxy-5-(phenylmethoxycarbonylamino)oxan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-4-acetyloxy-2-(hydroxymethyl)-6-methoxy-5-(phenylmethoxycarbonylamino)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 56630007 |
| Molecular Formula | C19H25NO9 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-4-acetyloxy-2-(hydroxymethyl)-6-methoxy-5-(phenylmethoxycarbonylamino)oxan-3-yl] acetate |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H25NO9/c1-11(22)27-16-14(9-21)29-18(25-3)15(17(16)28-12(2)23)20-19(24)26-10-13-7-5-4-6-8-13/h4-8,14-18,21H,9-10H2,1-3H3,(H,20,24)/t14-,15-,16-,17-,18+/m1/s1 |
| InChIKey | LDHDSLFNRUMTHF-ZKXLYKBJSA-N |
| XLogP | 0.51 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|