C18H24N4O7 — CID 71133069
[(2R,5S)-3-acetamido-2-azido-5-hydroxy-6-[(4-methoxyphenyl)methoxymethyl]oxan-4-yl] acetate (PubChem CID 71133069) has the molecular formula C18H24N4O7 and a molecular weight of 408.41 g/mol. Its IUPAC name is [(2R,5S)-3-acetamido-2-azido-5-hydroxy-6-[(4-methoxyphenyl)methoxymethyl]oxan-4-yl] acetate.
| Compound Name | [(2R,5S)-3-acetamido-2-azido-5-hydroxy-6-[(4-methoxyphenyl)methoxymethyl]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 71133069 |
| Molecular Formula | C18H24N4O7 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | [(2R,5S)-3-acetamido-2-azido-5-hydroxy-6-[(4-methoxyphenyl)methoxymethyl]oxan-4-yl] acetate |
| SMILES | COc1ccc(COCC2O[C@@H](N=[N+]=[N-])C(NC(C)=O)C(OC(C)=O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C18H24N4O7/c1-10(23)20-15-17(28-11(2)24)16(25)14(29-18(15)21-22-19)9-27-8-12-4-6-13(26-3)7-5-12/h4-7,14-18,25H,8-9H2,1-3H3,(H,20,23)/t14?,15?,16-,17?,18-/m1/s1 |
| InChIKey | RMYCSKGRALKCIO-BLEJJTAASA-N |
| XLogP | 1.04 |
| TPSA | 152.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|