C30H35N3O8 — CID 91184934
(3R,4R,5S,6R)-3-azido-4,5-bis[(4-methoxyphenyl)methoxy]-6-[(4-methoxyphenyl)methoxymethyl]oxan-2-ol (PubChem CID 91184934) has the molecular formula C30H35N3O8 and a molecular weight of 565.62 g/mol. Its IUPAC name is (3R,4R,5S,6R)-3-azido-4,5-bis[(4-methoxyphenyl)methoxy]-6-[(4-methoxyphenyl)methoxymethyl]oxan-2-ol.
| Compound Name | (3R,4R,5S,6R)-3-azido-4,5-bis[(4-methoxyphenyl)methoxy]-6-[(4-methoxyphenyl)methoxymethyl]oxan-2-ol |
|---|---|
| PubChem CID | 91184934 |
| Molecular Formula | C30H35N3O8 |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | (3R,4R,5S,6R)-3-azido-4,5-bis[(4-methoxyphenyl)methoxy]-6-[(4-methoxyphenyl)methoxymethyl]oxan-2-ol |
| SMILES | COc1ccc(COC[C@H]2OC(O)[C@H](N=[N+]=[N-])[C@@H](OCc3ccc(OC)cc3)[C@@H]2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H35N3O8/c1-35-23-10-4-20(5-11-23)16-38-19-26-28(39-17-21-6-12-24(36-2)13-7-21)29(27(32-33-31)30(34)41-26)40-18-22-8-14-25(37-3)15-9-22/h4-15,26-30,34H,16-19H2,1-3H3/t26-,27-,28-,29-,30?/m1/s1 |
| InChIKey | JJKNDTXWWLMMCX-BBSOXUCDSA-N |
| XLogP | 4.80 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|